ChemNet > CAS > 249278-25-9 1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one
249278-25-9 1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one
Nama produk |
1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one |
Sinonim |
1-[2-hydroxy-6-(3-methylbutoxy)phenyl]ethanone |
Nama Inggeris |
1-[2-hydroxy-6-(isopentyloxy)phenyl]ethan-1-one;1-[2-hydroxy-6-(3-methylbutoxy)phenyl]ethanone |
MF |
C13H18O3 |
Berat Molekul |
222.2802 |
InChI |
InChI=1/C13H18O3/c1-9(2)7-8-16-12-6-4-5-11(15)13(12)10(3)14/h4-6,9,15H,7-8H2,1-3H3 |
CAS NO |
249278-25-9 |
Struktur Molekul |
|
Kepadatan |
1.059g/cm3 |
Titik lebur |
25℃ |
Titik didih |
328°C at 760 mmHg |
Indeks bias |
1.515 |
Titik nyala |
118.2°C |
Tekanan wap |
0.000102mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|